Massive Selection for Vanadium Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex
Massive Selection for Vanadium Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex Detail:
Product Detail
|
NO |
Products |
CAS No |
Key Quality Indicator |
|||
|
Purity |
Max. impurity |
Total solvent residue |
Moisture |
|||
|
1 |
Fmoc-β-Ala-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
2 |
Fmoc-D-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
3 |
Fmoc-β-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
4 |
Fmoc-Arg(pbf)-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
5 |
Fmoc-β-Ala-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
6 |
Fmoc-D-Arg(pbf)-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
7 |
Fmoc-β-Ala-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
8 |
Fmoc-HomoArg(pbf)-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
9 |
Fmoc-β-Ala-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
10 |
Fmoc-Asn(Trt)-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
11 |
Fmoc-β-Ala-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
12 |
Fmoc-Asp(OtBu)-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
13 |
Fmoc-β-Ala-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
14 |
Fmoc-Cys(Trt)-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
15 |
Fmoc-β-Ala-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
16 |
Fmoc-Cys(Acm)-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
17 |
Fmoc-β-Ala-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
18 |
Fmoc-Gln(Trt)-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
19 |
Fmoc-β-Ala-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
20 |
Fmoc-Glu(OtBu)-Glu(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
21 |
Fmoc-β-Ala-Glu(OtBu)-OH.H2O |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
22 |
Fmoc-β-Ala-Gly-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
23 |
Fmoc-His(Trt)-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
24 |
Fmoc-β-Ala-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
25 |
Fmoc-Ile-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
26 |
Fmoc-β-Ala-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
27 |
Fmoc-Leu-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
28 |
Fmoc-β-Ala-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
29 |
Fmoc-D-Leu-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
30 |
Fmoc-β-Ala-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
31 |
Fmoc-Lys(Boc)-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
32 |
Fmoc-β-Ala-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
33 |
Fmoc-Lys(Alloc)-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
34 |
Fmoc-β-Ala-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
35 |
Fmoc-Met-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
36 |
Fmoc-β-Ala-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
37 |
Fmoc-Orn(Boc)-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
38 |
Fmoc-β-Ala-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
39 |
Fmoc-Phe-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
40 |
Fmoc-β-Ala-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
41 |
Fmoc-D-Phe-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
42 |
Fmoc-β-Ala-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
43 |
Fmoc-Pro-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
44 |
Fmoc-β-Ala-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
45 |
Fmoc-Ser(tBu)-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
46 |
Fmoc-β-Ala-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
47 |
Fmoc-Ser(Trt)-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
48 |
Fmoc-β-Ala-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
49 |
Fmoc-Thr(tBu)-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
50 |
Fmoc-β-Ala-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
51 |
Fmoc-Trp(Boc)-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
52 |
Fmoc-β-Ala-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
53 |
Fmoc-D-Trp(Boc)-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
54 |
Fmoc-β-Ala-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
55 |
Fmoc-Tyr(tBu)-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
56 |
Fmoc-β-Ala-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
57 |
Fmoc-D-Tyr(Et)-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
58 |
Fmoc-β-Ala-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
59 |
Fmoc-Tyr(Me)-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
60 |
Fmoc-β-Ala-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
61 |
Fmoc-Val-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
62 |
Fmoc-β-Ala-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
63 |
Fmoc-D-Cit-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
64 |
Fmoc-β-Ala-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
65 |
Fmoc-β-Ala-Dab-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
66 |
Fmoc-(3-(2-naphthyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
67 |
Fmoc-β-Ala-3-(2-naphthyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
68 |
Fmoc-(3-(3-pyridinyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
69 |
Fmoc-β-Ala-3-(3-pyridinyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
70 |
Fmoc-(4-chloro-D-Phe)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
71 |
Fmoc-β-Ala-4-chloro-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
72 |
Fmoc-(D-4Aph(tBuCbm))2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
73 |
Fmoc-β-Ala-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
74 |
Fmoc-Aph(L-Hor)-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
75 |
Fmoc-β-Ala-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
76 |
Fmoc-Lys(iPr,Boc)-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
77 |
Fmoc-β-Ala-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
78 |
Fmoc-β-Ala-AEEA-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
79 |
Fmoc-Aib-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
80 |
Fmoc-β-Ala-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
81 |
Fmoc-Arg-OH |
91000-69-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
82 |
H-Arg(pbf)-OH |
200115-86-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
83 |
Fmoc-D-Arg-OH |
130752-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
84 |
H-D-Arg(pbf)-OH |
200116-81-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
85 |
Fmoc-HomoArg-OH.HCl |
208174-14-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
86 |
H-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
87 |
Fmoc-D-HomoArg-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
88 |
H-D-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
89 |
Fmoc-Asn-OH |
71989-16-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
90 |
H-Asn(Trt)-OH |
132388-58-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
91 |
Fmoc-Asp-OH |
119062-05-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
92 |
H-Asp(OtBu)-OH |
3057-74-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
93 |
Fmoc-Cys-OH |
135248-89-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
94 |
H-Cys(Trt)-OH |
2799/7/7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
95 |
H-Cys(Acm)-OH.HCl |
28798-28-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
96 |
Fmoc-Gln-OH |
71989-20-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
97 |
H-Gln(Trt)-OH |
102747-84-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
98 |
Fmoc-Glu-OH |
121343-82-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
99 |
H-Glu(OtBu)-OH.H2O |
2419-56-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
100 |
Fmoc-His-OH |
116611-64-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
101 |
H-His(Trt)-OH |
35146-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
102 |
Boc-His-OH |
17791-52-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
103 |
Fmoc-Lys-OH |
105047-45-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
104 |
H-Lys(Boc)-OH |
2418-95-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
105 |
H-Lys(Alloc)-OH |
6298/3/9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
106 |
Fmoc-Orn-OH.HCl |
201046-57-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
107 |
H-Orn(Boc)-OH |
13650-49-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
108 |
Fmoc-Ser-OH |
73724-45-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
109 |
H-Ser(tBu)-OH |
18822-58-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
110 |
H-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
111 |
Fmoc-Thr-OH.H2O |
73731-37-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
112 |
H-Thr(tBu)-OH |
4378-13-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
113 |
Fmoc-Trp-OH |
35737-15-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
114 |
H-Trp(Boc)-OH |
146645-63-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
115 |
Fmoc-D-Trp-OH |
86123-11-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
116 |
H-D-Trp(Boc)-OH |
201290-11-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
117 |
Fmoc-Tyr-OH |
92954-90-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
118 |
H-Tyr(tBu)-OH |
18822-59-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
119 |
Fmoc-D-Tyr-OH |
112883-29-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
120 |
H-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
121 |
H-Tyr(Me)-OH.HCl |
67423-44-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
122 |
Fmoc-D-4Aph(Cbm)-OH |
324017-22-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
123 |
H-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
124 |
Fmoc-Lys(iPr)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
125 |
H-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
About
Compensation
Gentolex provide great quality products, if any product quality is raised by the client within the required time frame with sufficient evidences, we will provide necessary analysis and evaluation to trigger the procedures of compensations.
Production
The capacities of pharmaceutical products reached tons grade, the capacities of chemical products reach 100tons+ grade, the capabilities are well equipped to serve clients worldwide.
Research and Development
Every year, there is plan set up by the R&D team to develop different new products, when targets set, every member in the team will have to carry on with KPI responsibility and with incentive policy.
Product detail pictures:
Related Product Guide:
We always think and practice corresponding to the change of circumstance, and grow up. We aim at the achievement of a richer mind and body and the living for Massive Selection for Vanadium Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex , The product will supply to all over the world, such as: Surabaya, United States, Ukraine, When you are keen on any of our goods following you view our product list, be sure to feel free to make contact with us for inquiries. You'll be able to send us emails and get in touch with us for consultation and we shall respond to you as soon as we're able to. If it's convenient, you could find out our address in our web site and come to our enterprise. or additional information of our products by yourself. We're generally ready to build lengthy and steady co-operation relations with any possible shoppers within the associated fields.
By Beulah from Rome - 2018.06.03 10:17
We are old friends, the company's product quality has been always very good and this time the price is also very cheap.
By Annie from Kuwait - 2017.10.25 15:53
Related PRODUCTS
-
Discount Price Sulfur Amino Acids - Convention...
-
Chinese Professional Carnitine Amino Acid - Co...
-
Reasonable price Cas No 2393-23-9 - Ganirelix ...
-
Ordinary Discount Normal Chloride - GnRH Antag...
-
Chinese wholesale Vancomycin Medicine - 2,6-Di...
-
Factory Outlets Ethyl 4-Oxo-1-Piperidinecarboxy...