Manufacturing Companies for Terlipressin Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex
Manufacturing Companies for Terlipressin Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex Detail:
Product Detail
|
NO |
Products |
CAS No |
Key Quality Indicator |
|||
|
Purity |
Max. impurity |
Total solvent residue |
Moisture |
|||
|
1 |
Fmoc-β-Ala-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
2 |
Fmoc-D-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
3 |
Fmoc-β-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
4 |
Fmoc-Arg(pbf)-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
5 |
Fmoc-β-Ala-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
6 |
Fmoc-D-Arg(pbf)-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
7 |
Fmoc-β-Ala-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
8 |
Fmoc-HomoArg(pbf)-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
9 |
Fmoc-β-Ala-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
10 |
Fmoc-Asn(Trt)-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
11 |
Fmoc-β-Ala-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
12 |
Fmoc-Asp(OtBu)-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
13 |
Fmoc-β-Ala-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
14 |
Fmoc-Cys(Trt)-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
15 |
Fmoc-β-Ala-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
16 |
Fmoc-Cys(Acm)-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
17 |
Fmoc-β-Ala-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
18 |
Fmoc-Gln(Trt)-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
19 |
Fmoc-β-Ala-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
20 |
Fmoc-Glu(OtBu)-Glu(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
21 |
Fmoc-β-Ala-Glu(OtBu)-OH.H2O |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
22 |
Fmoc-β-Ala-Gly-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
23 |
Fmoc-His(Trt)-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
24 |
Fmoc-β-Ala-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
25 |
Fmoc-Ile-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
26 |
Fmoc-β-Ala-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
27 |
Fmoc-Leu-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
28 |
Fmoc-β-Ala-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
29 |
Fmoc-D-Leu-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
30 |
Fmoc-β-Ala-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
31 |
Fmoc-Lys(Boc)-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
32 |
Fmoc-β-Ala-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
33 |
Fmoc-Lys(Alloc)-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
34 |
Fmoc-β-Ala-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
35 |
Fmoc-Met-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
36 |
Fmoc-β-Ala-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
37 |
Fmoc-Orn(Boc)-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
38 |
Fmoc-β-Ala-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
39 |
Fmoc-Phe-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
40 |
Fmoc-β-Ala-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
41 |
Fmoc-D-Phe-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
42 |
Fmoc-β-Ala-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
43 |
Fmoc-Pro-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
44 |
Fmoc-β-Ala-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
45 |
Fmoc-Ser(tBu)-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
46 |
Fmoc-β-Ala-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
47 |
Fmoc-Ser(Trt)-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
48 |
Fmoc-β-Ala-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
49 |
Fmoc-Thr(tBu)-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
50 |
Fmoc-β-Ala-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
51 |
Fmoc-Trp(Boc)-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
52 |
Fmoc-β-Ala-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
53 |
Fmoc-D-Trp(Boc)-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
54 |
Fmoc-β-Ala-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
55 |
Fmoc-Tyr(tBu)-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
56 |
Fmoc-β-Ala-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
57 |
Fmoc-D-Tyr(Et)-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
58 |
Fmoc-β-Ala-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
59 |
Fmoc-Tyr(Me)-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
60 |
Fmoc-β-Ala-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
61 |
Fmoc-Val-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
62 |
Fmoc-β-Ala-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
63 |
Fmoc-D-Cit-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
64 |
Fmoc-β-Ala-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
65 |
Fmoc-β-Ala-Dab-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
66 |
Fmoc-(3-(2-naphthyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
67 |
Fmoc-β-Ala-3-(2-naphthyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
68 |
Fmoc-(3-(3-pyridinyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
69 |
Fmoc-β-Ala-3-(3-pyridinyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
70 |
Fmoc-(4-chloro-D-Phe)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
71 |
Fmoc-β-Ala-4-chloro-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
72 |
Fmoc-(D-4Aph(tBuCbm))2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
73 |
Fmoc-β-Ala-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
74 |
Fmoc-Aph(L-Hor)-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
75 |
Fmoc-β-Ala-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
76 |
Fmoc-Lys(iPr,Boc)-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
77 |
Fmoc-β-Ala-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
78 |
Fmoc-β-Ala-AEEA-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
79 |
Fmoc-Aib-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
80 |
Fmoc-β-Ala-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
81 |
Fmoc-Arg-OH |
91000-69-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
82 |
H-Arg(pbf)-OH |
200115-86-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
83 |
Fmoc-D-Arg-OH |
130752-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
84 |
H-D-Arg(pbf)-OH |
200116-81-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
85 |
Fmoc-HomoArg-OH.HCl |
208174-14-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
86 |
H-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
87 |
Fmoc-D-HomoArg-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
88 |
H-D-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
89 |
Fmoc-Asn-OH |
71989-16-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
90 |
H-Asn(Trt)-OH |
132388-58-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
91 |
Fmoc-Asp-OH |
119062-05-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
92 |
H-Asp(OtBu)-OH |
3057-74-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
93 |
Fmoc-Cys-OH |
135248-89-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
94 |
H-Cys(Trt)-OH |
2799/7/7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
95 |
H-Cys(Acm)-OH.HCl |
28798-28-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
96 |
Fmoc-Gln-OH |
71989-20-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
97 |
H-Gln(Trt)-OH |
102747-84-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
98 |
Fmoc-Glu-OH |
121343-82-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
99 |
H-Glu(OtBu)-OH.H2O |
2419-56-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
100 |
Fmoc-His-OH |
116611-64-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
101 |
H-His(Trt)-OH |
35146-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
102 |
Boc-His-OH |
17791-52-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
103 |
Fmoc-Lys-OH |
105047-45-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
104 |
H-Lys(Boc)-OH |
2418-95-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
105 |
H-Lys(Alloc)-OH |
6298/3/9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
106 |
Fmoc-Orn-OH.HCl |
201046-57-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
107 |
H-Orn(Boc)-OH |
13650-49-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
108 |
Fmoc-Ser-OH |
73724-45-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
109 |
H-Ser(tBu)-OH |
18822-58-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
110 |
H-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
111 |
Fmoc-Thr-OH.H2O |
73731-37-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
112 |
H-Thr(tBu)-OH |
4378-13-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
113 |
Fmoc-Trp-OH |
35737-15-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
114 |
H-Trp(Boc)-OH |
146645-63-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
115 |
Fmoc-D-Trp-OH |
86123-11-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
116 |
H-D-Trp(Boc)-OH |
201290-11-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
117 |
Fmoc-Tyr-OH |
92954-90-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
118 |
H-Tyr(tBu)-OH |
18822-59-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
119 |
Fmoc-D-Tyr-OH |
112883-29-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
120 |
H-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
121 |
H-Tyr(Me)-OH.HCl |
67423-44-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
122 |
Fmoc-D-4Aph(Cbm)-OH |
324017-22-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
123 |
H-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
124 |
Fmoc-Lys(iPr)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
125 |
H-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
About
Compensation
Gentolex provide great quality products, if any product quality is raised by the client within the required time frame with sufficient evidences, we will provide necessary analysis and evaluation to trigger the procedures of compensations.
Production
The capacities of pharmaceutical products reached tons grade, the capacities of chemical products reach 100tons+ grade, the capabilities are well equipped to serve clients worldwide.
Research and Development
Every year, there is plan set up by the R&D team to develop different new products, when targets set, every member in the team will have to carry on with KPI responsibility and with incentive policy.
Product detail pictures:
Related Product Guide:
With state-of-the-art technologies and facilities, strict good quality regulate, reasonable cost, exceptional assistance and close co-operation with prospects, we're devoted to supplying the top benefit for our customers for Manufacturing Companies for Terlipressin Acetate - Impurities of Amino Acid Used for Synthesize Protein – Gentolex , The product will supply to all over the world, such as: Ottawa, Sudan, Provence, we have 8 years experience of production and 5 years experience in trading with the customers all over the world. our clients mainly distributed in the North America, Africa and Eastern Europe. we can supply high quality products with the very competitive price.
By Samantha from kazan - 2017.03.07 13:42
The company can think what our think, the urgency of urgency to act in the interests of our position, can be said this is a responsible company, we had a happy cooperation!
By Joa from Las Vegas - 2018.12.30 10:21
Related PRODUCTS
-
Super Purchasing for Taurine Amino Acid - Lina...
-
Hot Sale for Bibw2992 Dimaleate - GLP-1 Protec...
-
Factory directly supply Vancomycin Type Of Anti...
-
Cheap PriceList for Cellulose Acetate - Vancom...
-
Reliable Supplier 2-(4-Hydroxy-6-Methylnicotina...
-
Good Quality Vancomycin Meningitis - GLP-1 Pro...