Good User Reputation for Non Protein Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex
Good User Reputation for Non Protein Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex Detail:
Product Detail
|
NO |
Products |
CAS No |
Key Quality Indicator |
|||
|
Purity |
Max. impurity |
Total solvent residue |
Moisture |
|||
|
1 |
Fmoc-β-Ala-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
2 |
Fmoc-D-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
3 |
Fmoc-β-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
4 |
Fmoc-Arg(pbf)-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
5 |
Fmoc-β-Ala-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
6 |
Fmoc-D-Arg(pbf)-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
7 |
Fmoc-β-Ala-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
8 |
Fmoc-HomoArg(pbf)-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
9 |
Fmoc-β-Ala-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
10 |
Fmoc-Asn(Trt)-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
11 |
Fmoc-β-Ala-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
12 |
Fmoc-Asp(OtBu)-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
13 |
Fmoc-β-Ala-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
14 |
Fmoc-Cys(Trt)-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
15 |
Fmoc-β-Ala-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
16 |
Fmoc-Cys(Acm)-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
17 |
Fmoc-β-Ala-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
18 |
Fmoc-Gln(Trt)-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
19 |
Fmoc-β-Ala-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
20 |
Fmoc-Glu(OtBu)-Glu(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
21 |
Fmoc-β-Ala-Glu(OtBu)-OH.H2O |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
22 |
Fmoc-β-Ala-Gly-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
23 |
Fmoc-His(Trt)-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
24 |
Fmoc-β-Ala-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
25 |
Fmoc-Ile-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
26 |
Fmoc-β-Ala-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
27 |
Fmoc-Leu-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
28 |
Fmoc-β-Ala-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
29 |
Fmoc-D-Leu-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
30 |
Fmoc-β-Ala-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
31 |
Fmoc-Lys(Boc)-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
32 |
Fmoc-β-Ala-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
33 |
Fmoc-Lys(Alloc)-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
34 |
Fmoc-β-Ala-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
35 |
Fmoc-Met-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
36 |
Fmoc-β-Ala-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
37 |
Fmoc-Orn(Boc)-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
38 |
Fmoc-β-Ala-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
39 |
Fmoc-Phe-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
40 |
Fmoc-β-Ala-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
41 |
Fmoc-D-Phe-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
42 |
Fmoc-β-Ala-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
43 |
Fmoc-Pro-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
44 |
Fmoc-β-Ala-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
45 |
Fmoc-Ser(tBu)-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
46 |
Fmoc-β-Ala-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
47 |
Fmoc-Ser(Trt)-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
48 |
Fmoc-β-Ala-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
49 |
Fmoc-Thr(tBu)-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
50 |
Fmoc-β-Ala-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
51 |
Fmoc-Trp(Boc)-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
52 |
Fmoc-β-Ala-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
53 |
Fmoc-D-Trp(Boc)-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
54 |
Fmoc-β-Ala-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
55 |
Fmoc-Tyr(tBu)-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
56 |
Fmoc-β-Ala-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
57 |
Fmoc-D-Tyr(Et)-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
58 |
Fmoc-β-Ala-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
59 |
Fmoc-Tyr(Me)-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
60 |
Fmoc-β-Ala-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
61 |
Fmoc-Val-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
62 |
Fmoc-β-Ala-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
63 |
Fmoc-D-Cit-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
64 |
Fmoc-β-Ala-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
65 |
Fmoc-β-Ala-Dab-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
66 |
Fmoc-(3-(2-naphthyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
67 |
Fmoc-β-Ala-3-(2-naphthyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
68 |
Fmoc-(3-(3-pyridinyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
69 |
Fmoc-β-Ala-3-(3-pyridinyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
70 |
Fmoc-(4-chloro-D-Phe)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
71 |
Fmoc-β-Ala-4-chloro-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
72 |
Fmoc-(D-4Aph(tBuCbm))2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
73 |
Fmoc-β-Ala-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
74 |
Fmoc-Aph(L-Hor)-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
75 |
Fmoc-β-Ala-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
76 |
Fmoc-Lys(iPr,Boc)-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
77 |
Fmoc-β-Ala-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
78 |
Fmoc-β-Ala-AEEA-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
79 |
Fmoc-Aib-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
80 |
Fmoc-β-Ala-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
81 |
Fmoc-Arg-OH |
91000-69-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
82 |
H-Arg(pbf)-OH |
200115-86-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
83 |
Fmoc-D-Arg-OH |
130752-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
84 |
H-D-Arg(pbf)-OH |
200116-81-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
85 |
Fmoc-HomoArg-OH.HCl |
208174-14-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
86 |
H-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
87 |
Fmoc-D-HomoArg-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
88 |
H-D-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
89 |
Fmoc-Asn-OH |
71989-16-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
90 |
H-Asn(Trt)-OH |
132388-58-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
91 |
Fmoc-Asp-OH |
119062-05-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
92 |
H-Asp(OtBu)-OH |
3057-74-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
93 |
Fmoc-Cys-OH |
135248-89-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
94 |
H-Cys(Trt)-OH |
2799/7/7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
95 |
H-Cys(Acm)-OH.HCl |
28798-28-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
96 |
Fmoc-Gln-OH |
71989-20-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
97 |
H-Gln(Trt)-OH |
102747-84-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
98 |
Fmoc-Glu-OH |
121343-82-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
99 |
H-Glu(OtBu)-OH.H2O |
2419-56-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
100 |
Fmoc-His-OH |
116611-64-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
101 |
H-His(Trt)-OH |
35146-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
102 |
Boc-His-OH |
17791-52-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
103 |
Fmoc-Lys-OH |
105047-45-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
104 |
H-Lys(Boc)-OH |
2418-95-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
105 |
H-Lys(Alloc)-OH |
6298/3/9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
106 |
Fmoc-Orn-OH.HCl |
201046-57-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
107 |
H-Orn(Boc)-OH |
13650-49-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
108 |
Fmoc-Ser-OH |
73724-45-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
109 |
H-Ser(tBu)-OH |
18822-58-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
110 |
H-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
111 |
Fmoc-Thr-OH.H2O |
73731-37-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
112 |
H-Thr(tBu)-OH |
4378-13-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
113 |
Fmoc-Trp-OH |
35737-15-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
114 |
H-Trp(Boc)-OH |
146645-63-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
115 |
Fmoc-D-Trp-OH |
86123-11-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
116 |
H-D-Trp(Boc)-OH |
201290-11-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
117 |
Fmoc-Tyr-OH |
92954-90-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
118 |
H-Tyr(tBu)-OH |
18822-59-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
119 |
Fmoc-D-Tyr-OH |
112883-29-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
120 |
H-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
121 |
H-Tyr(Me)-OH.HCl |
67423-44-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
122 |
Fmoc-D-4Aph(Cbm)-OH |
324017-22-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
123 |
H-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
124 |
Fmoc-Lys(iPr)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
125 |
H-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
About
Compensation
Gentolex provide great quality products, if any product quality is raised by the client within the required time frame with sufficient evidences, we will provide necessary analysis and evaluation to trigger the procedures of compensations.
Production
The capacities of pharmaceutical products reached tons grade, the capacities of chemical products reach 100tons+ grade, the capabilities are well equipped to serve clients worldwide.
Research and Development
Every year, there is plan set up by the R&D team to develop different new products, when targets set, every member in the team will have to carry on with KPI responsibility and with incentive policy.
Product detail pictures:
Related Product Guide:
We insist on offering high quality production with good business concept, honest sales and the best and fast service. it will bring you not only the high quality product and huge profit, but the most significant is to occupy the endless market for Good User Reputation for Non Protein Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex , The product will supply to all over the world, such as: Sierra Leone, Poland, Philadelphia, Since the establishment of our company, we have realized the importance of providing good quality products and the best before-sales and after-sales services. Most problems between global suppliers and clients are due to poor communication. Culturally, suppliers can be reluctant to question things they do not understand. We break down those barriers to ensure you get what you want to the level you expect, when you want it.
By Rae from Stuttgart - 2018.12.14 15:26
The customer service staff is very patient and has a positive and progressive attitude to our interest, so that we can have a comprehensive understanding of the product and finally we reached an agreement, thanks!
By Caroline from Miami - 2018.06.12 16:22
Related PRODUCTS
-
Factory Cheap Hot Low Sodium Potassium And Chlo...
-
China Factory for Piperidine Derivative - Gani...
-
Factory Promotional Tab Caspofungin - Carbetoc...
-
Factory directly supply Vancomycin Type Of Anti...
-
Europe style for Ostarine - Terlipressin Aceta...
-
Massive Selection for 25 Sorafenib - GLP-1 Pro...