Cheap price 4 Bromophenylacetonitrile - Impurities of Amino Acid Used for Synthesize Protein – Gentolex
Cheap price 4 Bromophenylacetonitrile - Impurities of Amino Acid Used for Synthesize Protein – Gentolex Detail:
Product Detail
|
NO |
Products |
CAS No |
Key Quality Indicator |
|||
|
Purity |
Max. impurity |
Total solvent residue |
Moisture |
|||
|
1 |
Fmoc-β-Ala-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
2 |
Fmoc-D-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
3 |
Fmoc-β-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
4 |
Fmoc-Arg(pbf)-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
5 |
Fmoc-β-Ala-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
6 |
Fmoc-D-Arg(pbf)-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
7 |
Fmoc-β-Ala-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
8 |
Fmoc-HomoArg(pbf)-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
9 |
Fmoc-β-Ala-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
10 |
Fmoc-Asn(Trt)-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
11 |
Fmoc-β-Ala-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
12 |
Fmoc-Asp(OtBu)-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
13 |
Fmoc-β-Ala-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
14 |
Fmoc-Cys(Trt)-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
15 |
Fmoc-β-Ala-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
16 |
Fmoc-Cys(Acm)-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
17 |
Fmoc-β-Ala-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
18 |
Fmoc-Gln(Trt)-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
19 |
Fmoc-β-Ala-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
20 |
Fmoc-Glu(OtBu)-Glu(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
21 |
Fmoc-β-Ala-Glu(OtBu)-OH.H2O |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
22 |
Fmoc-β-Ala-Gly-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
23 |
Fmoc-His(Trt)-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
24 |
Fmoc-β-Ala-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
25 |
Fmoc-Ile-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
26 |
Fmoc-β-Ala-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
27 |
Fmoc-Leu-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
28 |
Fmoc-β-Ala-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
29 |
Fmoc-D-Leu-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
30 |
Fmoc-β-Ala-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
31 |
Fmoc-Lys(Boc)-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
32 |
Fmoc-β-Ala-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
33 |
Fmoc-Lys(Alloc)-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
34 |
Fmoc-β-Ala-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
35 |
Fmoc-Met-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
36 |
Fmoc-β-Ala-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
37 |
Fmoc-Orn(Boc)-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
38 |
Fmoc-β-Ala-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
39 |
Fmoc-Phe-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
40 |
Fmoc-β-Ala-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
41 |
Fmoc-D-Phe-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
42 |
Fmoc-β-Ala-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
43 |
Fmoc-Pro-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
44 |
Fmoc-β-Ala-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
45 |
Fmoc-Ser(tBu)-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
46 |
Fmoc-β-Ala-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
47 |
Fmoc-Ser(Trt)-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
48 |
Fmoc-β-Ala-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
49 |
Fmoc-Thr(tBu)-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
50 |
Fmoc-β-Ala-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
51 |
Fmoc-Trp(Boc)-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
52 |
Fmoc-β-Ala-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
53 |
Fmoc-D-Trp(Boc)-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
54 |
Fmoc-β-Ala-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
55 |
Fmoc-Tyr(tBu)-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
56 |
Fmoc-β-Ala-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
57 |
Fmoc-D-Tyr(Et)-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
58 |
Fmoc-β-Ala-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
59 |
Fmoc-Tyr(Me)-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
60 |
Fmoc-β-Ala-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
61 |
Fmoc-Val-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
62 |
Fmoc-β-Ala-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
63 |
Fmoc-D-Cit-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
64 |
Fmoc-β-Ala-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
65 |
Fmoc-β-Ala-Dab-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
66 |
Fmoc-(3-(2-naphthyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
67 |
Fmoc-β-Ala-3-(2-naphthyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
68 |
Fmoc-(3-(3-pyridinyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
69 |
Fmoc-β-Ala-3-(3-pyridinyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
70 |
Fmoc-(4-chloro-D-Phe)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
71 |
Fmoc-β-Ala-4-chloro-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
72 |
Fmoc-(D-4Aph(tBuCbm))2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
73 |
Fmoc-β-Ala-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
74 |
Fmoc-Aph(L-Hor)-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
75 |
Fmoc-β-Ala-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
76 |
Fmoc-Lys(iPr,Boc)-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
77 |
Fmoc-β-Ala-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
78 |
Fmoc-β-Ala-AEEA-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
79 |
Fmoc-Aib-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
80 |
Fmoc-β-Ala-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
81 |
Fmoc-Arg-OH |
91000-69-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
82 |
H-Arg(pbf)-OH |
200115-86-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
83 |
Fmoc-D-Arg-OH |
130752-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
84 |
H-D-Arg(pbf)-OH |
200116-81-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
85 |
Fmoc-HomoArg-OH.HCl |
208174-14-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
86 |
H-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
87 |
Fmoc-D-HomoArg-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
88 |
H-D-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
89 |
Fmoc-Asn-OH |
71989-16-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
90 |
H-Asn(Trt)-OH |
132388-58-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
91 |
Fmoc-Asp-OH |
119062-05-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
92 |
H-Asp(OtBu)-OH |
3057-74-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
93 |
Fmoc-Cys-OH |
135248-89-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
94 |
H-Cys(Trt)-OH |
2799/7/7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
95 |
H-Cys(Acm)-OH.HCl |
28798-28-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
96 |
Fmoc-Gln-OH |
71989-20-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
97 |
H-Gln(Trt)-OH |
102747-84-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
98 |
Fmoc-Glu-OH |
121343-82-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
99 |
H-Glu(OtBu)-OH.H2O |
2419-56-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
100 |
Fmoc-His-OH |
116611-64-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
101 |
H-His(Trt)-OH |
35146-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
102 |
Boc-His-OH |
17791-52-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
103 |
Fmoc-Lys-OH |
105047-45-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
104 |
H-Lys(Boc)-OH |
2418-95-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
105 |
H-Lys(Alloc)-OH |
6298/3/9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
106 |
Fmoc-Orn-OH.HCl |
201046-57-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
107 |
H-Orn(Boc)-OH |
13650-49-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
108 |
Fmoc-Ser-OH |
73724-45-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
109 |
H-Ser(tBu)-OH |
18822-58-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
110 |
H-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
111 |
Fmoc-Thr-OH.H2O |
73731-37-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
112 |
H-Thr(tBu)-OH |
4378-13-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
113 |
Fmoc-Trp-OH |
35737-15-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
114 |
H-Trp(Boc)-OH |
146645-63-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
115 |
Fmoc-D-Trp-OH |
86123-11-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
116 |
H-D-Trp(Boc)-OH |
201290-11-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
117 |
Fmoc-Tyr-OH |
92954-90-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
118 |
H-Tyr(tBu)-OH |
18822-59-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
119 |
Fmoc-D-Tyr-OH |
112883-29-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
120 |
H-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
121 |
H-Tyr(Me)-OH.HCl |
67423-44-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
122 |
Fmoc-D-4Aph(Cbm)-OH |
324017-22-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
123 |
H-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
124 |
Fmoc-Lys(iPr)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
125 |
H-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
About
Compensation
Gentolex provide great quality products, if any product quality is raised by the client within the required time frame with sufficient evidences, we will provide necessary analysis and evaluation to trigger the procedures of compensations.
Production
The capacities of pharmaceutical products reached tons grade, the capacities of chemical products reach 100tons+ grade, the capabilities are well equipped to serve clients worldwide.
Research and Development
Every year, there is plan set up by the R&D team to develop different new products, when targets set, every member in the team will have to carry on with KPI responsibility and with incentive policy.
Product detail pictures:
Related Product Guide:
We aim to find out high quality disfigurement in the generation and provide the most effective services to domestic and abroad clients wholeheartedly for Cheap price 4 Bromophenylacetonitrile - Impurities of Amino Acid Used for Synthesize Protein – Gentolex , The product will supply to all over the world, such as: Casablanca, Turkey, Washington, The products has a good reputation with competitive price, unique creation, leading the industry trends. The company insists on the principle of win-win idea, has establishedglobal sales network and after-sales service network.
By Natalie from New Zealand - 2018.03.03 13:09
We always believe that the details decides the company's product quality, in this respect, the company conform our requirements and the goods are meet our expectations.
By Sarah from Auckland - 2018.11.28 16:25
Related PRODUCTS
-
professional factory for Limiting Amino Acid In...
-
Professional China Salmeterol - Desmopressin A...
-
Good Quality Ter Amino Acid - Eptifibatide for...
-
Reliable Supplier Glutathione Amino Acids - Va...
-
Well-designed Exenatide - Ganirelix Acetate Pe...
-
Manufacturing Companies for Cas 319460-85-0 - ...