100% Original Human Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex
100% Original Human Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex Detail:
Product Detail
|
NO |
Products |
CAS No |
Key Quality Indicator |
|||
|
Purity |
Max. impurity |
Total solvent residue |
Moisture |
|||
|
1 |
Fmoc-β-Ala-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
2 |
Fmoc-D-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
3 |
Fmoc-β-Ala-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
4 |
Fmoc-Arg(pbf)-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
5 |
Fmoc-β-Ala-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
6 |
Fmoc-D-Arg(pbf)-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
7 |
Fmoc-β-Ala-D-Arg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
8 |
Fmoc-HomoArg(pbf)-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
9 |
Fmoc-β-Ala-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
10 |
Fmoc-Asn(Trt)-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
11 |
Fmoc-β-Ala-Asn(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
12 |
Fmoc-Asp(OtBu)-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
13 |
Fmoc-β-Ala-Asp(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
14 |
Fmoc-Cys(Trt)-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
15 |
Fmoc-β-Ala-Cys(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
16 |
Fmoc-Cys(Acm)-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
17 |
Fmoc-β-Ala-Cys(Acm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
18 |
Fmoc-Gln(Trt)-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
19 |
Fmoc-β-Ala-Gln(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
20 |
Fmoc-Glu(OtBu)-Glu(OtBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
21 |
Fmoc-β-Ala-Glu(OtBu)-OH.H2O |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
22 |
Fmoc-β-Ala-Gly-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
23 |
Fmoc-His(Trt)-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
24 |
Fmoc-β-Ala-His(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
25 |
Fmoc-Ile-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
26 |
Fmoc-β-Ala-Ile-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
27 |
Fmoc-Leu-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
28 |
Fmoc-β-Ala-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
29 |
Fmoc-D-Leu-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
30 |
Fmoc-β-Ala-D-Leu-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
31 |
Fmoc-Lys(Boc)-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
32 |
Fmoc-β-Ala-Lys(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
33 |
Fmoc-Lys(Alloc)-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
34 |
Fmoc-β-Ala-Lys(Alloc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
35 |
Fmoc-Met-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
36 |
Fmoc-β-Ala-Met-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
37 |
Fmoc-Orn(Boc)-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
38 |
Fmoc-β-Ala-Orn(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
39 |
Fmoc-Phe-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
40 |
Fmoc-β-Ala-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
41 |
Fmoc-D-Phe-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
42 |
Fmoc-β-Ala-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
43 |
Fmoc-Pro-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
44 |
Fmoc-β-Ala-Pro-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
45 |
Fmoc-Ser(tBu)-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
46 |
Fmoc-β-Ala-Ser(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
47 |
Fmoc-Ser(Trt)-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
48 |
Fmoc-β-Ala-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
49 |
Fmoc-Thr(tBu)-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
50 |
Fmoc-β-Ala-Thr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
51 |
Fmoc-Trp(Boc)-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
52 |
Fmoc-β-Ala-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
53 |
Fmoc-D-Trp(Boc)-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
54 |
Fmoc-β-Ala-D-Trp(Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
55 |
Fmoc-Tyr(tBu)-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
56 |
Fmoc-β-Ala-Tyr(tBu)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
57 |
Fmoc-D-Tyr(Et)-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
58 |
Fmoc-β-Ala-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
59 |
Fmoc-Tyr(Me)-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
60 |
Fmoc-β-Ala-Tyr(Me)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
61 |
Fmoc-Val-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
62 |
Fmoc-β-Ala-Val-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
63 |
Fmoc-D-Cit-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
64 |
Fmoc-β-Ala-D-Cit-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
65 |
Fmoc-β-Ala-Dab-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
66 |
Fmoc-(3-(2-naphthyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
67 |
Fmoc-β-Ala-3-(2-naphthyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
68 |
Fmoc-(3-(3-pyridinyl)-D-Ala)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
69 |
Fmoc-β-Ala-3-(3-pyridinyl)-D-Ala-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
70 |
Fmoc-(4-chloro-D-Phe)2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
71 |
Fmoc-β-Ala-4-chloro-D-Phe-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
72 |
Fmoc-(D-4Aph(tBuCbm))2-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
73 |
Fmoc-β-Ala-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
74 |
Fmoc-Aph(L-Hor)-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
75 |
Fmoc-β-Ala-Aph(L-Hor)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
76 |
Fmoc-Lys(iPr,Boc)-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
77 |
Fmoc-β-Ala-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
78 |
Fmoc-β-Ala-AEEA-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
79 |
Fmoc-Aib-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
80 |
Fmoc-β-Ala-Aib-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
81 |
Fmoc-Arg-OH |
91000-69-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
82 |
H-Arg(pbf)-OH |
200115-86-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
83 |
Fmoc-D-Arg-OH |
130752-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
84 |
H-D-Arg(pbf)-OH |
200116-81-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
85 |
Fmoc-HomoArg-OH.HCl |
208174-14-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
86 |
H-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
87 |
Fmoc-D-HomoArg-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
88 |
H-D-HomoArg(pbf)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
89 |
Fmoc-Asn-OH |
71989-16-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
90 |
H-Asn(Trt)-OH |
132388-58-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
91 |
Fmoc-Asp-OH |
119062-05-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
92 |
H-Asp(OtBu)-OH |
3057-74-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
93 |
Fmoc-Cys-OH |
135248-89-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
94 |
H-Cys(Trt)-OH |
2799/7/7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
95 |
H-Cys(Acm)-OH.HCl |
28798-28-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
96 |
Fmoc-Gln-OH |
71989-20-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
97 |
H-Gln(Trt)-OH |
102747-84-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
98 |
Fmoc-Glu-OH |
121343-82-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
99 |
H-Glu(OtBu)-OH.H2O |
2419-56-9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
100 |
Fmoc-His-OH |
116611-64-4 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
101 |
H-His(Trt)-OH |
35146-32-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
102 |
Boc-His-OH |
17791-52-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
103 |
Fmoc-Lys-OH |
105047-45-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
104 |
H-Lys(Boc)-OH |
2418-95-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
105 |
H-Lys(Alloc)-OH |
6298/3/9 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
106 |
Fmoc-Orn-OH.HCl |
201046-57-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
107 |
H-Orn(Boc)-OH |
13650-49-2 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
108 |
Fmoc-Ser-OH |
73724-45-5 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
109 |
H-Ser(tBu)-OH |
18822-58-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
110 |
H-Ser(Trt)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
111 |
Fmoc-Thr-OH.H2O |
73731-37-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
112 |
H-Thr(tBu)-OH |
4378-13-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
113 |
Fmoc-Trp-OH |
35737-15-6 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
114 |
H-Trp(Boc)-OH |
146645-63-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
115 |
Fmoc-D-Trp-OH |
86123-11-7 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
116 |
H-D-Trp(Boc)-OH |
201290-11-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
117 |
Fmoc-Tyr-OH |
92954-90-0 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
118 |
H-Tyr(tBu)-OH |
18822-59-8 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
119 |
Fmoc-D-Tyr-OH |
112883-29-1 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
120 |
H-D-Tyr(Et)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
121 |
H-Tyr(Me)-OH.HCl |
67423-44-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
122 |
Fmoc-D-4Aph(Cbm)-OH |
324017-22-3 |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
123 |
H-D-4Aph(tBuCbm)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
124 |
Fmoc-Lys(iPr)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
|
125 |
H-Lys(iPr,Boc)-OH |
NA |
≥98.0% |
≤1.0% |
≤8.0% |
≤2.0% |
About
Compensation
Gentolex provide great quality products, if any product quality is raised by the client within the required time frame with sufficient evidences, we will provide necessary analysis and evaluation to trigger the procedures of compensations.
Production
The capacities of pharmaceutical products reached tons grade, the capacities of chemical products reach 100tons+ grade, the capabilities are well equipped to serve clients worldwide.
Research and Development
Every year, there is plan set up by the R&D team to develop different new products, when targets set, every member in the team will have to carry on with KPI responsibility and with incentive policy.
Product detail pictures:
Related Product Guide:
We've our have sales staff, style and design staff, technical crew, QC team and package workforce. We've strict excellent control procedures for each system. Also, all of our workers are experienced in printing field for 100% Original Human Amino Acids - Impurities of Amino Acid Used for Synthesize Protein – Gentolex , The product will supply to all over the world, such as: Egypt, Buenos Aires, Thailand, Our product quality is one of the major concerns and has been produced to meet the customer's standards. "Customer services and relationship" is another important area which we understand good communication and relationships with our customers is the most significant power to run it as a long term business.
By Mandy from Hongkong - 2017.08.16 13:39
In China, we have purchased many times, this time is the most successful and most satisfactory, a sincere and realiable Chinese manufacturer!
By Carol from Slovenia - 2017.07.28 15:46
Related PRODUCTS
-
factory customized Mrsa Treatment Vancomycin -...
-
Chinese wholesale Vancomycin Medicine - Orlist...
-
Leading Manufacturer for Naturally Occurring Am...
-
Factory directly supply Gadoteric Acid - 1-(4-...
-
100% Original Sodium Pyrithione_Spt 3811-73-2 -...
-
Cheapest Factory Boc-Ser-Oh - Micafungin for a...